71686-05-0 dinitrophenol, compound with 4,5-dihydro-2-methyl-1H-imidazole (1:1) |
název výrobku |
dinitrophenol, compound with 4,5-dihydro-2-methyl-1H-imidazole (1:1) |
Anglický název |
dinitrophenol, compound with 4,5-dihydro-2-methyl-1H-imidazole (1:1);Dinitrophenol, compound with 4,5-dihydro-2-methyl-1H-imidazole (1:1);2,3-dinitrophenol; 2-methyl-4,5-dihydro-1H-imidazole |
Molekulární vzorec |
C10H12N4O5 |
Molekulová hmotnost |
268.2261 |
InChl |
InChI=1/C6H4N2O5.C4H8N2/c9-5-3-1-2-4(7(10)11)6(5)8(12)13;1-4-5-2-3-6-4/h1-3,9H;2-3H2,1H3,(H,5,6) |
Registrační číslo CAS |
71686-05-0 |
EINECS |
275-847-4 |
Molekulární struktura |
|
Bod varu |
494.3°C at 760 mmHg |
Bod vzplanutí |
252.8°C |
Tlak par |
2.14E-10mmHg at 25°C |
MSDS |
Material Safety Data Sheet |