892674-22-5 2,7-dimethylquinoline-4-carboxylic acid |
|
| Product Name | 2,7-dimethylquinoline-4-carboxylic acid |
| Synonyms | 4-quinolinecarboxylic acid, 2,7-dimethyl- |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.2212 |
| InChl | InChI=1/C12H11NO2/c1-7-3-4-9-10(12(14)15)6-8(2)13-11(9)5-7/h3-6H,1-2H3,(H,14,15) |
| CAS Registry Number | 892674-22-5 |
| Molecular Structure |  |
| Density | 1.243g/cm3 |
| Boiling Point | 359.7°C at 760 mmHg |
| Refractive Index | 1.646 |
| Flash Point | 171.3°C |
| Vapour Pressur | 8.44E-06mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
