7683-81-0 N-2-4-dnp-L-aspartic acid |
|
| Product Name | N-2-4-dnp-L-aspartic acid |
| Synonyms | N-(2,4-Dinitrophenyl)-L-aspartic acid;N-(2,4-dinitrophenyl)aspartic acid |
| Molecular Formula | C10H9N3O8 |
| Molecular Weight | 299.1938 |
| InChl | InChI=1/C10H9N3O8/c14-9(15)4-7(10(16)17)11-6-2-1-5(12(18)19)3-8(6)13(20)21/h1-3,7,11H,4H2,(H,14,15)(H,16,17) |
| CAS Registry Number | 7683-81-0 |
| EINECS | 231-688-2 |
| Molecular Structure |  |
| Density | 1.742g/cm3 |
| Boiling Point | 563.6°C at 760 mmHg |
| Refractive Index | 1.694 |
| Flash Point | 294.7°C |
| Vapour Pressur | 1.53E-13mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
