7465-87-4 N-benzyl-4-methoxybenzamide |
|
| Product Name | N-benzyl-4-methoxybenzamide |
| Synonyms | Benzamide, 4-methoxy-N-(phenylmethyl)-;N-Benzyl-4-methoxybenzamide |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.2851 |
| InChl | InChI=1/C15H15NO2/c1-18-14-9-7-13(8-10-14)15(17)16-11-12-5-3-2-4-6-12/h2-10H,11H2,1H3,(H,16,17) |
| CAS Registry Number | 7465-87-4 |
| Molecular Structure |  |
| Density | 1.124g/cm3 |
| Boiling Point | 441.2°C at 760 mmHg |
| Refractive Index | 1.576 |
| Flash Point | 220.6°C |
| Vapour Pressur | 5.56E-08mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
