6909-93-9 2,5-Diamino-4-picoline |
| Product Name |
2,5-Diamino-4-picoline |
| Synonyms |
4-methylpyridine-2,5-diamine;2,5-diamino-4-methylpyridinium |
| Molecular Formula |
C6H10N3 |
| Molecular Weight |
124.1632 |
| InChl |
InChI=1/C6H9N3/c1-4-2-6(8)9-3-5(4)7/h2-3H,7H2,1H3,(H2,8,9)/p+1 |
| CAS Registry Number |
6909-93-9 |
| Molecular Structure |
 |
| Boiling Point |
333°C at 760 mmHg |
| Flash Point |
181.6°C |
| Vapour Pressur |
0.000141mmHg at 25°C |
| Hazard Symbols |
 Xi##Irritant:;
|
| Risk Codes |
R36/37/38##Irritating to eyes, respiratory system and skin.:;
|
| Safety Description |
S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:;
|
