59089-89-3 Ethylenedithiodithiolethione |
|
| Product Name | Ethylenedithiodithiolethione |
| Synonyms | 4,5-Ethylenedithio-1,3-dithiole-2-thione;5,6-Dihydro-1,3-dithiolo[4,5-b][1,4]dithiin-2-thione;5,6-dihydro[1,3]dithiolo[4,5-b][1,4]dithiine-2-thione |
| Molecular Formula | C5H4S5 |
| Molecular Weight | 224.4103 |
| InChl | InChI=1/C5H4S5/c6-5-9-3-4(10-5)8-2-1-7-3/h1-2H2 |
| CAS Registry Number | 59089-89-3 |
| Molecular Structure |  |
| Density | 1.74g/cm3 |
| Melting Point | 123-126℃ |
| Boiling Point | 359°C at 760 mmHg |
| Refractive Index | 1.896 |
| Flash Point | 170.9°C |
| Vapour Pressur | 5.05E-05mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
