58142-97-5 1-chloro-5-nitroisoquinoline |
|
| Product Name | 1-chloro-5-nitroisoquinoline |
| Synonyms | 1-Chloro-5-nitroisoquinoline;isoquinoline, 1-chloro-5-nitro- |
| Molecular Formula | C9H5ClN2O2 |
| Molecular Weight | 208.6012 |
| InChl | InChI=1/C9H5ClN2O2/c10-9-7-2-1-3-8(12(13)14)6(7)4-5-11-9/h1-5H |
| CAS Registry Number | 58142-97-5 |
| Molecular Structure |  |
| Density | 1.484g/cm3 |
| Boiling Point | 376.8°C at 760 mmHg |
| Refractive Index | 1.688 |
| Flash Point | 181.7°C |
| Vapour Pressur | 1.53E-05mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
