56859-91-7 ethyl furan-3-propionate |
|
| Product Name | ethyl furan-3-propionate |
| Synonyms | Ethyl furan-3-propionate;ethyl 3-(furan-3-yl)propanoate |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.1898 |
| InChl | InChI=1/C9H12O3/c1-2-12-9(10)4-3-8-5-6-11-7-8/h5-7H,2-4H2,1H3 |
| CAS Registry Number | 56859-91-7 |
| EINECS | 260-406-0 |
| Molecular Structure |  |
| Density | 1.064g/cm3 |
| Boiling Point | 211.4°C at 760 mmHg |
| Refractive Index | 1.466 |
| Flash Point | 90.5°C |
| Vapour Pressur | 0.183mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
