56424-77-2 Ethyl O-carboethoxymethylsalicylate |
| Product Name |
Ethyl O-carboethoxymethylsalicylate |
| Synonyms |
Ethyl 2-(ethoxycarbonylmethoxy)benzoate;ethyl 2-(2-ethoxy-2-oxoethoxy)benzoate |
| Molecular Formula |
C13H16O5 |
| Molecular Weight |
252.2631 |
| InChl |
InChI=1/C13H16O5/c1-3-16-12(14)9-18-11-8-6-5-7-10(11)13(15)17-4-2/h5-8H,3-4,9H2,1-2H3 |
| CAS Registry Number |
56424-77-2 |
| Molecular Structure |
 |
| Density |
1.142g/cm3 |
| Boiling Point |
344.9°C at 760 mmHg |
| Refractive Index |
1.5 |
| Flash Point |
150.3°C |
| Vapour Pressur |
6.39E-05mmHg at 25°C |
| Safety Description |
S24/25##Avoid contact with skin and eyes.:;
|
