5392-82-5 2,5-dichlorophenyl isocyanate |
|
| Product Name | 2,5-dichlorophenyl isocyanate |
| Synonyms | Isocyanic acid 2,5-dichlorophenyl ester;2,5-Dichloroisocyanatobenzene;1,4-dichloro-2-isocyanatobenzene |
| Molecular Formula | C7H3Cl2NO |
| Molecular Weight | 188.0108 |
| InChl | InChI=1/C7H3Cl2NO/c8-5-1-2-6(9)7(3-5)10-4-11/h1-3H |
| CAS Registry Number | 5392-82-5 |
| EINECS | 226-396-7 |
| Molecular Structure |  |
| Density | 1.37g/cm3 |
| Melting Point | 29-31℃ |
| Boiling Point | 241.6°C at 760 mmHg |
| Refractive Index | 1.575 |
| Flash Point | 92°C |
| Vapour Pressur | 0.0356mmHg at 25°C |
| Risk Codes | R23/25##Toxic by inhalation and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.||R42##May cause sensitization by inhalation.:; |
| Safety Description | S23##Do not inhale gas/fumes/vapour/spray.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
- J&H Chemical Co.,ltd
TEL:+86-571-87396430 / 87396432
FAX:+86-571-87396431
