52726-26-8 1-butyl-5-methyl-1H-imidazole |
|
| Product Name | 1-butyl-5-methyl-1H-imidazole |
| Synonyms | 1H-Imidazole, 1-butyl-5-methyl |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.2102 |
| InChl | InChI=1/C8H14N2/c1-3-4-5-10-7-9-6-8(10)2/h6-7H,3-5H2,1-2H3 |
| CAS Registry Number | 52726-26-8 |
| Molecular Structure |  |
| Density | 0.94g/cm3 |
| Boiling Point | 258.5°C at 760 mmHg |
| Refractive Index | 1.506 |
| Flash Point | 110.1°C |
| Vapour Pressur | 0.0221mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
