51977-21-0 ethyl thiazolidine-4-carboxylate |
|
| Product Name | ethyl thiazolidine-4-carboxylate |
| Synonyms | Ethyl thiazolidine-4-carboxylate;ethyl 1,3-thiazolidine-4-carboxylate |
| Molecular Formula | C6H11NO2S |
| Molecular Weight | 161.222 |
| InChl | InChI=1/C6H11NO2S/c1-2-9-6(8)5-3-10-4-7-5/h5,7H,2-4H2,1H3 |
| CAS Registry Number | 51977-21-0 |
| EINECS | 257-567-4 |
| Molecular Structure |  |
| Density | 1.165g/cm3 |
| Boiling Point | 254.2°C at 760 mmHg |
| Refractive Index | 1.503 |
| Flash Point | 107.6°C |
| Vapour Pressur | 0.0174mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
