51079-10-8 ethyl indol-3-ylglyoxylate |
|
| Product Name | ethyl indol-3-ylglyoxylate |
| Synonyms | Ethyl indol-3-ylglyoxylate;ethyl 1H-indol-3-yl(oxo)acetate |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.2206 |
| InChl | InChI=1/C12H11NO3/c1-2-16-12(15)11(14)9-7-13-10-6-4-3-5-8(9)10/h3-7,13H,2H2,1H3 |
| CAS Registry Number | 51079-10-8 |
| EINECS | 256-954-5 |
| Molecular Structure |  |
| Density | 1.278g/cm3 |
| Boiling Point | 391.7°C at 760 mmHg |
| Refractive Index | 1.618 |
| Flash Point | 190.7°C |
| Vapour Pressur | 2.41E-06mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
