50375-08-1 1-chloro-3,5-diethoxybenzene |
|
| Product Name | 1-chloro-3,5-diethoxybenzene |
| Synonyms | 1-Chloro-3,5-diethoxybenzene |
| Molecular Formula | C10H13ClO2 |
| Molecular Weight | 200.662 |
| InChl | InChI=1/C10H13ClO2/c1-3-12-9-5-8(11)6-10(7-9)13-4-2/h5-7H,3-4H2,1-2H3 |
| CAS Registry Number | 50375-08-1 |
| EINECS | 256-560-3 |
| Molecular Structure |  |
| Density | 1.1g/cm3 |
| Boiling Point | 273.8°C at 760 mmHg |
| Refractive Index | 1.501 |
| Flash Point | 97.2°C |
| Vapour Pressur | 0.0094mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
