483367-56-2 3,6-dichloro-2-(thiophen-2-yl)imidazo[1,2-b]pyridazine |
|
| Product Name | 3,6-dichloro-2-(thiophen-2-yl)imidazo[1,2-b]pyridazine |
| Synonyms | 3,6-Dichlor-2-(thiophen-2-yl)imidazo[1,2-b]pyridazin;3,6-Dichloro-2-(2-thienyl)imidazo[1,2-b]pyridazine;3,6-Dichloro-2-(thiophen-2-yl)imidazo[1,2-b]pyridazine;imidazo[1,2-b]pyridazine, 3,6-dichloro-2-(2-thienyl)- |
| Molecular Formula | C10H5Cl2N3S |
| Molecular Weight | 270.1378 |
| InChl | InChI=1/C10H5Cl2N3S/c11-7-3-4-8-13-9(6-2-1-5-16-6)10(12)15(8)14-7/h1-5H |
| CAS Registry Number | 483367-56-2 |
| Molecular Structure |  |
| Density | 1.67g/cm3 |
| Refractive Index | 1.785 |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
