4507-13-5 Zinostatin |
|
| Product Name | Zinostatin |
| Synonyms | Ethyl 2-amino-5-ethyl-3-thenoate;ethyl 2-amino-5-ethylthiophene-3-carboxylate |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.27 |
| InChl | InChI=1/C9H13NO2S/c1-3-6-5-7(8(10)13-6)9(11)12-4-2/h5H,3-4,10H2,1-2H3 |
| CAS Registry Number | 4507-13-5 |
| EINECS | 224-824-7 |
| Molecular Structure |  |
| Density | 1.183g/cm3 |
| Boiling Point | 312.7°C at 760 mmHg |
| Refractive Index | 1.564 |
| Flash Point | 142.9°C |
| Vapour Pressur | 0.00052mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
