42780-41-6 (1,2-dimethyl-5-phenyl-1H-pyrrol-3-yl)acetic acid |
|
| Product Name | (1,2-dimethyl-5-phenyl-1H-pyrrol-3-yl)acetic acid |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.2744 |
| InChl | InChI=1/C14H15NO2/c1-10-12(9-14(16)17)8-13(15(10)2)11-6-4-3-5-7-11/h3-8H,9H2,1-2H3,(H,16,17) |
| CAS Registry Number | 42780-41-6 |
| Molecular Structure |  |
| Density | 1.12g/cm3 |
| Boiling Point | 393.6°C at 760 mmHg |
| Refractive Index | 1.571 |
| Flash Point | 191.8°C |
| Vapour Pressur | 6.69E-07mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
