4180-62-5 Z-Gly-Ser-OH |
|
| Product Name | Z-Gly-Ser-OH |
| Synonyms | N-[(benzyloxy)carbonyl]glycylserine |
| Molecular Formula | C13H16N2O6 |
| Molecular Weight | 296.2759 |
| InChl | InChI=1/C13H16N2O6/c16-7-10(12(18)19)15-11(17)6-14-13(20)21-8-9-4-2-1-3-5-9/h1-5,10,16H,6-8H2,(H,14,20)(H,15,17)(H,18,19) |
| CAS Registry Number | 4180-62-5 |
| Molecular Structure |  |
| Density | 1.374g/cm3 |
| Boiling Point | 641.7°C at 760 mmHg |
| Refractive Index | 1.573 |
| Flash Point | 341.9°C |
| Vapour Pressur | 2.4E-17mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
