3696-36-4 1-isoquinolylboronic acid |
|
| Product Name | 1-isoquinolylboronic acid |
| Synonyms | boronic acid, B-1-isoquinolinyl-;Isoquinolin-1-ylboronic acid |
| Molecular Formula | C9H8BNO2 |
| Molecular Weight | 172.9763 |
| InChl | InChI=1/C9H8BNO2/c12-10(13)9-8-4-2-1-3-7(8)5-6-11-9/h1-6,12-13H |
| CAS Registry Number | 3696-36-4 |
| Molecular Structure |  |
| Density | 1.289g/cm3 |
| Boiling Point | 419.115°C at 760 mmHg |
| Refractive Index | 1.645 |
| Flash Point | 207.274°C |
| Vapour Pressur | 0mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
