3521-91-3 1-Hepten-4-ol |
|
| Product Name | 1-Hepten-4-ol |
| Synonyms | AI3-28622;NSC 163329;hept-1-en-4-ol;(4S)-hept-1-en-4-ol;(4R)-hept-1-en-4-ol |
| Molecular Formula | C7H14O |
| Molecular Weight | 114.1855 |
| InChl | InChI=1/C7H14O/c1-3-5-7(8)6-4-2/h3,7-8H,1,4-6H2,2H3/t7-/m0/s1 |
| CAS Registry Number | 3521-91-3 |
| EINECS | 222-535-0 |
| Molecular Structure |  |
| Density | 0.833g/cm3 |
| Boiling Point | 152.1°C at 760 mmHg |
| Refractive Index | 1.434 |
| Flash Point | 56.4°C |
| Vapour Pressur | 1.33mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
