332927-03-4 Acridine-9-carboxylic acid hydrate |
|
| Product Name | Acridine-9-carboxylic acid hydrate |
| Synonyms | acridine-9-carboxylic acid;acridine-9-carboxylate |
| Molecular Formula | C14H9NO2 |
| Molecular Weight | 222.2194 |
| InChl | InChI=1/C14H9NO2/c16-14(17)13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H,(H,16,17)/p-1 |
| CAS Registry Number | 332927-03-4 |
| Molecular Structure |  |
| Melting Point | 290℃ |
| Boiling Point | 480.4°C at 760 mmHg |
| Flash Point | 244.3°C |
| Vapour Pressur | 4.88E-10mmHg at 25°C |
| Hazard Symbols |  Xi##Irritant:; |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
- ENDOTHERM GmbH
TEL:++49 (0) 681-3946-7570
FAX:++49 (0) 681-3946-7571 - GenoLite Biotek
TEL:503 - 223 - 7773 /877-Genolit (436
FAX:(503)-223-7774
