3262-03-1 1-chloro-3,4-dihydronaphthalene-2-carbaldehyde |
|
| Product Name | 1-chloro-3,4-dihydronaphthalene-2-carbaldehyde |
| Synonyms | 1-Chloro-3,4-dihydronaphthalene-2-carbaldehyde |
| Molecular Formula | C11H9ClO |
| Molecular Weight | 192.6416 |
| InChl | InChI=1/C11H9ClO/c12-11-9(7-13)6-5-8-3-1-2-4-10(8)11/h1-4,7H,5-6H2 |
| CAS Registry Number | 3262-03-1 |
| EINECS | 221-866-8 |
| Molecular Structure |  |
| Density | 1.24g/cm3 |
| Boiling Point | 311.4°C at 760 mmHg |
| Refractive Index | 1.592 |
| Flash Point | 154.5°C |
| Vapour Pressur | 0.000564mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
