3205-94-5 1-cyclopentene-1,2-dicarboxylic anhydride |
|
| Product Name | 1-cyclopentene-1,2-dicarboxylic anhydride |
| Synonyms | 5,6-dihydro-1H-cyclopenta[c]furan-1,3(4H)-dione |
| Molecular Formula | C7H6O3 |
| Molecular Weight | 138.1207 |
| InChl | InChI=1/C7H6O3/c8-6-4-2-1-3-5(4)7(9)10-6/h1-3H2 |
| CAS Registry Number | 3205-94-5 |
| Molecular Structure |  |
| Density | 1.37g/cm3 |
| Boiling Point | 268.7°C at 760 mmHg |
| Refractive Index | 1.544 |
| Flash Point | 143.7°C |
| Vapour Pressur | 0.00758mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
