31983-42-3 diheptyl maleate |
|
| Product Name | diheptyl maleate |
| Synonyms | Diheptyl maleate;diheptyl (2Z)-but-2-enedioate |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.4443 |
| InChl | InChI=1/C18H32O4/c1-3-5-7-9-11-15-21-17(19)13-14-18(20)22-16-12-10-8-6-4-2/h13-14H,3-12,15-16H2,1-2H3/b14-13- |
| CAS Registry Number | 31983-42-3 |
| EINECS | 250-884-9 |
| Molecular Structure |  |
| Density | 0.957g/cm3 |
| Boiling Point | 389.2°C at 760 mmHg |
| Refractive Index | 1.458 |
| Flash Point | 181.8°C |
| Vapour Pressur | 2.91E-06mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
