25415-76-3 pentyl 2-butenoate |
|
| Product Name | pentyl 2-butenoate |
| Synonyms | Pentyl 2-butenoate;AI3-06016;2-Butenoic acid, pentyl ester;pentyl but-2-enoate;pentyl (2Z)-but-2-enoate;pentyl (2E)-but-2-enoate |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.2221 |
| InChl | InChI=1/C9H16O2/c1-3-5-6-8-11-9(10)7-4-2/h4,7H,3,5-6,8H2,1-2H3/b7-4+ |
| CAS Registry Number | 25415-76-3 |
| EINECS | 246-956-4 |
| Molecular Structure |  |
| Density | 0.896g/cm3 |
| Boiling Point | 194.6°C at 760 mmHg |
| Refractive Index | 1.436 |
| Flash Point | 77.9°C |
| Vapour Pressur | 0.437mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
