22708-14-1 pentyl o-anisate |
|
| Product Name | pentyl o-anisate |
| Synonyms | Pentyl o-anisate;pentyl 2-methoxybenzoate |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.2802 |
| InChl | InChI=1/C13H18O3/c1-3-4-7-10-16-13(14)11-8-5-6-9-12(11)15-2/h5-6,8-9H,3-4,7,10H2,1-2H3 |
| CAS Registry Number | 22708-14-1 |
| EINECS | 245-166-7 |
| Molecular Structure |  |
| Density | 1.022g/cm3 |
| Boiling Point | 309°C at 760 mmHg |
| Refractive Index | 1.493 |
| Flash Point | 126.2°C |
| Vapour Pressur | 0.000655mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
