22034-13-5 4-bromo-2,1,3-benzothiadiazole |
|
| Product Name | 4-bromo-2,1,3-benzothiadiazole |
| Molecular Formula | C6H3BrN2S |
| Molecular Weight | 215.0704 |
| InChl | InChI=1/C6H3BrN2S/c7-4-2-1-3-5-6(4)9-10-8-5/h1-3H |
| CAS Registry Number | 22034-13-5 |
| Molecular Structure |  |
| Density | 1.859g/cm3 |
| Melting Point | 83℃ |
| Boiling Point | 272.2°C at 760 mmHg |
| Refractive Index | 1.733 |
| Flash Point | 118.4°C |
| Vapour Pressur | 0.0103mmHg at 25°C |
| Hazard Symbols |  Xi##Irritant:; |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
- Life Chemicals Inc.
TEL:+19056345212
FAX:+19056344719
