20199-04-6 1-phenyl-1-sulfinylmethanamine |
|
| Product Name | 1-phenyl-1-sulfinylmethanamine |
| Synonyms | (Z)-[amino(phenyl)methylene]sulfoniumolate;1-Phenyl-1-sulfinylmethanamine;benzenemethanamine, alpha-sulfinyl- |
| Molecular Formula | C7H7NOS |
| Molecular Weight | 153.2016 |
| InChl | InChI=1/C7H7NOS/c8-7(10-9)6-4-2-1-3-5-6/h1-5H,8H2 |
| CAS Registry Number | 20199-04-6 |
| Molecular Structure |  |
| Density | 1.22g/cm3 |
| Boiling Point | 271.1°C at 760 mmHg |
| Refractive Index | 1.6 |
| Flash Point | 117.8°C |
| Vapour Pressur | 0.00658mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
