10328-92-4 N-Methylisatoic anhydride |
| Product Name |
N-Methylisatoic anhydride |
| Synonyms |
MIA;N-Methylisatoic Anhydride;1-methyl-2H-3,1-benzoxazine-2,4(1H)-dione |
| Molecular Formula |
C9H7NO3 |
| Molecular Weight |
177.1568 |
| InChl |
InChI=1/C9H7NO3/c1-10-7-5-3-2-4-6(7)8(11)13-9(10)12/h2-5H,1H3 |
| CAS Registry Number |
10328-92-4 |
| EINECS |
233-714-8 |
| Molecular Structure |
 |
| Density |
1.348g/cm3 |
| Melting Point |
165℃ |
| Boiling Point |
297.5°C at 760 mmHg |
| Refractive Index |
1.583 |
| Flash Point |
133.7°C |
| Vapour Pressur |
0.00135mmHg at 25°C |
| Hazard Symbols |
 Xi##Irritant:;
|
| Risk Codes |
R36/37/38##Irritating to eyes, respiratory system and skin.:;
|
| Safety Description |
S24/25##Avoid contact with skin and eyes.:;
|
