99-21-8 N-(4-amino-5-methoxy-2-methylphenyl)benzamide |
| Product Name |
N-(4-amino-5-methoxy-2-methylphenyl)benzamide |
| Synonyms |
Benzamide, N-(4-amino-5-methoxy-2-methylphenyl)-;4'-Amino-5'-methoxy-2'-methylbenzanilide;4-amino-5-methoxy-2-methyl-N-phenylbenzamide;Fast Violet Base B;FAST VIOLER B BASE |
| Molecular Formula |
C15H16N2O2 |
| Molecular Weight |
256.2997 |
| InChl |
InChI=1/C15H16N2O2/c1-10-8-13(16)14(19-2)9-12(10)15(18)17-11-6-4-3-5-7-11/h3-9H,16H2,1-2H3,(H,17,18) |
| CAS Registry Number |
99-21-8 |
| EINECS |
202-740-1 |
| Molecular Structure |
 |
| Density |
1.215g/cm3 |
| Melting Point |
185℃ |
| Boiling Point |
384.7°C at 760 mmHg |
| Refractive Index |
1.646 |
| Flash Point |
186.5°C |
| Vapour Pressur |
4.01E-06mmHg at 25°C |
| Safety Description |
S24/25##Avoid contact with skin and eyes.:;
|
